| Name |
Corymbosin 5-Hydroxy-3',4',5',7-tetramethoxyflavone 5-Hydroxy-7-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
18103-41-8 |
| C_ID |
C00003917
, 
|
| InChIKey |
FLCVGMVLNHYJAW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-11-7-12(20)18-13(21)9-14(26-15(18)8-11)10-5-16(23-2)19(25-4)17(6-10)24-3/h5-9,20H,1-4H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea incana | Ref. |
| Plantae | Melastomataceae | Webera corymbosa | Ref. |
| Plantae | Meliaceae | Walsura piscidia | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| - | - | Tuebina corymbosa | Ref. |
|
|
zoom in
| Organism | Webera corymbosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tetrahedron Lett.,(1967),4579 |
|---|
|