| Name |
Hypolaetin 8,3',4'-trimethyl ether 5,7-Dihydroxy-8,3',4'-trimethoxyflavone 3',4'-Dimethoxywogonin 2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-8-methoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
36810-81-8 |
| C_ID |
C00003910
, 
|
| InChIKey |
YSSFBMRXSHCURK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-13-5-4-9(6-15(13)23-2)14-8-11(20)16-10(19)7-12(21)17(24-3)18(16)25-14/h4-8,19,21H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(OC)c3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Cowania mexicana var. Stansburiana  | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
|
|
zoom in
| Organism | Gardenia lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Kumari,Fitoterapia,60,(1989),558 |
|---|
|