| Name |
Hypolaetin 8,3'-dimethyl ether 5,7,4'-Trihydroxy-8,3'-dimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
24126-72-5 |
| C_ID |
C00003909
, 
|
| InChIKey |
XHBFGFPZSKMOQP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-14-5-8(3-4-9(14)18)13-7-11(20)15-10(19)6-12(21)16(23-2)17(15)24-13/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)c(OC)c3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline tomentosa  | Ref. |
| Plantae | Asteraceae | Ambrosia dumosa | Ref. |
| Plantae | Asteraceae | Conyza spp. | Ref. |
| Plantae | Asteraceae | Doronicum grandiflorum | Ref. |
| Plantae | Asteraceae | Hemizonia lutescens | Ref. |
| Plantae | Solanaceae | Solanum grayi | Ref. |
|
|
zoom in
| Organism | Ambrosia dumosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Seaman,Phytochem.,11,(1972),2626
Reynaud,Pharmazie,38,(1983),628 |
|---|
|