| Name |
Viscidulin II |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
92519-93-2 |
| C_ID |
C00003902
, 
|
| InChIKey |
GWRFNPJGKCUUSJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-13-7-11(21)15-10(20)6-12(24-17(15)16(13)23-2)14-8(18)4-3-5-9(14)19/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3c(O)cccc3O)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
| Plantae | Labiatae | Scutellaria viscidula | Ref. |
|
|
zoom in
| Organism | Scutellaria indica |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tomimori,Shoyakugaku Zasshi,38,(1984),249
Miyaichi,Chem.Pharm.Bull.,35,(1987),3720 |
|---|
|
