| Name |
Isoscutellarein 7,8-dimethyl ether |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
6608-33-9 |
| C_ID |
C00003852
, 
|
| InChIKey |
FTFPXINQVCVDEY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-8-12(20)15-11(19)7-13(23-17(15)16(14)22-2)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Argyroxiphium sandwicense | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Wilkesia hobdyi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Iinuma, Yakugaku Zasshi, 100,(1980),657
Bohm,Phytochem.,29,(1990),1175 |
|---|
|