| Name |
Geraldone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
21583-32-4 |
| C_ID |
C00003826
, 
|
| InChIKey |
OUMMPAFEQHTYIZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-16-6-9(2-5-12(16)18)14-8-13(19)11-4-3-10(17)7-15(11)21-14/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(-c2cc(=O)c3ccc(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Tephrosia pumila  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Vochysiaceae | Salvertia convallariodora | Ref. |
| Plantae | Vochysiaceae | Vochysia einnamonea | Ref. |
|
|
zoom in
| Organism | Trifolium repens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|