| Name |
5,7,2'-Trihydroxyflavone |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
73046-40-9 |
| C_ID |
C00003815
, 
|
| InChIKey |
OFYPDAKTVZXXPC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-8-5-11(18)15-12(19)7-13(20-14(15)6-8)9-3-1-2-4-10(9)17/h1-7,16-18H |
| SMILES |
O=c1cc(-c2ccccc2O)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria rivularis  | Ref. |
| Plantae | Labiatae | Scutellaria strigillosa | Ref. |
|
|
zoom in
| Organism | Scutellaria baicalensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tomimori,Yakugaku Zasshi,104,(1984),524
Tomimori,ShoyakugakuZasshi,40,(1986),432 |
|---|
|