| Name |
2',5'-Dihydroxyflavone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
92439-19-5 |
| C_ID |
C00003803
, 
|
| InChIKey |
QOULGRDJCDSRNP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-9-5-6-12(17)11(7-9)15-8-13(18)10-3-1-2-4-14(10)19-15/h1-8,16-17H |
| SMILES |
O=c1cc(-c2cc(O)ccc2O)oc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Primulaceae | Primula farinose | Ref. |
| Plantae | Primulaceae | Primula pulverulenta | Ref. |
| Plantae | Primulaceae | Primula spp. | Ref. |
|
|
zoom in
| Organism | Primula pulverulenta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Wollenweber,Naturforsch.,C,43,(1988)305 |
|---|
|