| Name |
Isopratol 4'-Hydroxy-7-methoxyflavone |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
32272-23-4 |
| C_ID |
C00003801
, 
|
| InChIKey |
DZUKXCCSULKRJA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-19-12-6-7-13-14(18)9-15(20-16(13)8-12)10-2-4-11(17)5-3-10/h2-9,17H,1H3 |
| SMILES |
COc1ccc2c(=O)cc(-c3ccc(O)cc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bauhinia guianensis  | Ref. |
| Plantae | Fabaceae | Trifolium hybridum  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
|
|
zoom in
| Organism | Trifolium hybridum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fraishtat, P.D., Khim.Prir.Soedin.,(1981),663. |
|---|
|