| Name |
5,2'-Dihydroxyflavone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
6674-39-1 |
| C_ID |
C00003796
, 
|
| InChIKey |
QAGGRDVXPIXVDQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-5-2-1-4-9(10)14-8-12(18)15-11(17)6-3-7-13(15)19-14/h1-8,16-17H |
| SMILES |
O=c1cc(-c2ccccc2O)oc2cccc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum denticulata | Ref. |
| Plantae | Primulaceae | Primula modesta | Ref. |
| Plantae | Primulaceae | Primula pulverulenta | Ref. |
|
|
zoom in
| Organism | Primula modesta |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemstry of the Flavons,(1967), Academic Press |
|---|
|
