| Name |
5,6-Dimethoxyflavone |
| Formula |
C17H14O4 |
| Mw |
282.08920894 |
| CAS RN |
33554-48-2 |
| C_ID |
C00003793
, 
|
| InChIKey |
GHLJEZSMMHWXTR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O4/c1-19-14-9-8-13-16(17(14)20-2)12(18)10-15(21-13)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| SMILES |
COc1ccc2oc(-c3ccccc3)cc(=O)c2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Casimiroa edulis  | Ref. |
| Plantae | Rutaceae | Sargentia greggii | Ref. |
|
|
zoom in
| Organism | Sargentia greggii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids, (1967) Academic Press. |
|---|
|