| Name |
5-Hydroxy-6-methoxyflavone |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
85395-95-5 |
| C_ID |
C00003792
, 
|
| InChIKey |
KQFFAKXFTDOCIR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-19-13-8-7-12-15(16(13)18)11(17)9-14(20-12)10-5-3-2-4-6-10/h2-9,18H,1H3 |
| SMILES |
COc1ccc2oc(-c3ccccc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Primulaceae | Primula acaulis  | Ref. |
| Plantae | Primulaceae | Primula pulverulenta | Ref. |
| Plantae | Primulaceae | Primula sinensis | Ref. |
|
|
zoom in
| Organism | Primula pulverulenta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Wollenweber, Biochem. Physiol.Pflanz., 181,(1986),665 |
|---|
|