| Name |
Poriferasterol Stigmasta-5,22-dien-3beta-ol (24S)24-Ethylcholesta-5,22-dien-3beta-ol |
| Formula |
C29H48O |
| Mw |
412.37051615 |
| CAS RN |
481-16-3 |
| C_ID |
C00003668
, 
|
| InChIKey |
HCXVJBMSMIARIN-ITDLQSHYNA-N |
| InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21-,23-,24-,25+,26-,27-,28-,29+/m0/s1 |
| SMILES |
CC[C@@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Plantae | Araliaceae | Schefflera arboricola  | Ref. |
| Plantae | Chlorellaceae | Chlorella spp. | Ref. |
| - | - | Chloromorum toxicum | Ref. |
| - | - | Ochromonas malhamensis | Ref. |
|
|
zoom in
| Organism | Physarum polycephalum | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function of Sterols in Fungi,Advances in Lipid Rese |
|---|
|