| Name |
Lanceotoxin B |
| Formula |
C32H44O11 |
| Mw |
604.28836225 |
| CAS RN |
93801-98-3 |
| C_ID |
C00003629
, 
|
| InChIKey |
IKNIMVNUBXHADS-OBKQSYKANA-N |
| InChICode |
InChI=1S/C32H44O11/c1-17-25(36)26(37)27(38)28(41-17)42-20-6-11-30(16-33)22-7-10-29(3)21(19-4-5-24(35)40-15-19)9-13-32(29,39)23(22)8-12-31(30,14-20)43-18(2)34/h4-5,15-17,20-23,25-28,36-39H,6-14H2,1-3H3/t17-,20+,21-,22+,23-,25+,26+,27-,28-,29-,30+,31+,32+/m1/s1 |
| SMILES |
CC(=O)O[C@]12CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](c5ccc(=O)oc5)CC[C@]34O)[C@@]1(C=O)CC[C@H](O[C@@H]1OC(C)[C@H](O)[C@H](O)C1O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Kalanchoe lanceolata  | Ref. |
| - | - | Kalonchoe lanceolata | Ref. |
|
|
zoom in
| Organism | Kalonchoe lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|