| Name |
Lanceotoxin A |
| Formula |
C32H44O12 |
| Mw |
620.28327687 |
| CAS RN |
93771-82-5 |
| C_ID |
C00003628
, 
|
| InChIKey |
IDZGCABQJKWSHL-PGDPEEDUNA-N |
| InChICode |
InChI=1S/C32H44O12/c1-17(34)25(37)26(38)27(39)28(40)43-20-6-11-30(16-33)22-7-10-29(3)21(19-4-5-24(36)42-15-19)9-13-32(29,41)23(22)8-12-31(30,14-20)44-18(2)35/h4-5,15-17,20-23,25-27,34,37-39,41H,6-14H2,1-3H3/t17-,20-,21+,22-,23+,25-,26+,27+,29+,30-,31-,32-/m0/s1 |
| SMILES |
CC(=O)O[C@]12CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](c5ccc(=O)oc5)CC[C@]34O)[C@@]1(C=O)CC[C@H](OC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Kalanchoe lanceolata  | Ref. |
| - | - | Kalonchoe lanceolata | Ref. |
|
|
zoom in
| Organism | Kalonchoe lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|