| Name |
Bryophyllin A |
| Formula |
C26H32O8 |
| Mw |
472.209718 |
| CAS RN |
105608-32-0 |
| C_ID |
C00003606
, 
|
| InChIKey |
BMRNQSAXDJQXEL-YZHLKAJONA-N |
| InChICode |
InChI=1S/C26H32O8/c1-22-11-18(28)21-17(26(22,30)8-6-16(22)14-3-4-20(29)31-12-14)5-7-24-10-15-9-19(25(21,24)13-27)33-23(2,32-15)34-24/h3-4,12-13,15-19,21,28,30H,5-11H2,1-2H3/t15-,16+,17+,18+,19+,21+,22+,23-,24-,25+,26-/m0/s1 |
| SMILES |
C[C@@]12O[C@H]3C[C@@H](O1)[C@]1(C=O)[C@H]4[C@H](O)C[C@]5(C)[C@@H](c6ccc(=O)oc6)CC[C@]5(O)[C@@H]4CC[C@@]1(C3)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Crassulaceae | Kalanchoe gracilis | Ref. |
| Plantae | Crassulaceae | Kalanchoe pinnata  | Ref. |
|
|
zoom in
| Organism | Kalanchoe gracilis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|