| Name |
Nuatigenin |
| Formula |
C27H42O4 |
| Mw |
430.30830983 |
| CAS RN |
6811-35-4 |
| C_ID |
C00003581
, 
|
| InChIKey |
NELZMZLNTYWIPD-BSMITSPPNA-N |
| InChICode |
InChI=1S/C27H42O4/c1-16-23-22(30-27(16)12-11-24(2,15-28)31-27)14-21-19-6-5-17-13-18(29)7-9-25(17,3)20(19)8-10-26(21,23)4/h5,16,18-23,28-29H,6-15H2,1-4H3/t16-,18-,19+,20-,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| SMILES |
C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)O[C@]12CC[C@@](C)(CO)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Poaceae | Avena sativa  | Ref. |
| Plantae | Solanaceae | Solanum aculeatissimum | Ref. |
| Plantae | Solanaceae | Solanum globiferum | Ref. |
| Plantae | Solanaceae | Solanum melongena | Ref. |
| Plantae | Solanaceae | Solanum sisymbriifolium | Ref. |
|
|
zoom in
| Organism | Solanum aculeatissimum |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
