| Name |
Pisiferic acid |
| Formula |
C20H28O3 |
| Mw |
316.20384476 |
| CAS RN |
67494-15-9 |
| C_ID |
C00003470
, 
|
| InChIKey |
ATHWSPHADLLZSS-ODFXZGDXNA-N |
| InChICode |
InChI=1S/C20H28O3/c1-12(2)14-10-13-6-7-17-19(3,4)8-5-9-20(17,18(22)23)15(13)11-16(14)21/h10-12,17,21H,5-9H2,1-4H3,(H,22,23)/t17-,20-/m0/s1 |
| SMILES |
CC(C)c1cc2c(cc1O)[C@@]1(C(=O)O)CCCC(C)(C)[C@@H]1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Labiatae | Isodon glutinosa | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia blepharochaena Hedge and Hub.Mor. | Ref. |
| Plantae | Labiatae | Salvia blepharochlaena | Ref. |
|
|
zoom in
| Organism | Chamaecyparis pisifera | | Reference | Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter52 |
|---|
|