| Name |
Inflexin |
| Formula |
C24H32O7 |
| Mw |
432.21480338 |
| CAS RN |
39388-66-4 |
| C_ID |
C00003438
, 
|
| InChIKey |
YVMIOJMVICZZJA-NJSHPMPQNA-N |
| InChICode |
InChI=1S/C24H32O7/c1-11-14-7-15(27)20-23(6)18(31-13(3)26)8-17(30-12(2)25)22(4,5)19(23)16(28)10-24(20,9-14)21(11)29/h14-15,17-20,27H,1,7-10H2,2-6H3/t14-,15-,17+,18-,19-,20+,23-,24+/m1/s1 |
| SMILES |
C=C1C(=O)[C@@]23CC(=O)[C@@H]4C(C)(C)[C@@H](OC(C)=O)C[C@@H](OC(C)=O)[C@@]4(C)[C@@H]2[C@H](O)C[C@@H]1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Isodon excisus | Ref. |
| Plantae | Labiatae | Isodon inflexa | Ref. |
| Plantae | Labiatae | Isodon inflexus | Ref. |
| Plantae | Labiatae | Isodon lungshengensis | Ref. |
| Plantae | Lamiaceae | Rabdosia inflexa | Ref. |
|
|
zoom in
| Organism | Isodon inflexa |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
