| Name |
Vernoflexin Vernoflexine Zaluzanin C senecioate |
| Formula |
C20H24O4 |
| Mw |
328.16745925 |
| CAS RN |
57576-43-9 |
| C_ID |
C00003386
, 
|
| InChIKey |
CEKDWOBPPFOCDL-VTJZKLMFNA-N |
| InChICode |
InChI=1S/C20H24O4/c1-10(2)8-17(21)23-16-9-15-11(3)6-7-14-12(4)20(22)24-19(14)18(15)13(16)5/h8,14-16,18-19H,3-7,9H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| SMILES |
C=C1[C@@H]2[C@H]3OC(=O)C(=C)[C@@H]3CCC(=C)[C@@H]2C[C@@H]1OC(=O)C=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Vernonia arkansana | Ref. |
| Plantae | Asteraceae | Vernonia chinense | Ref. |
| Plantae | Asteraceae | Vernonia chinensis | Ref. |
| Plantae | Asteraceae | Vernonia flexuosa | Ref. |
|
|
zoom in
| Organism | Vernonia chinense | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|