| Name |
Saupirin sauparine |
| Formula |
C19H22O6 |
| Mw |
346.14163844 |
| CAS RN |
35932-39-9 |
| C_ID |
C00003366
, 
|
| InChIKey |
KHSCYOFDKADJDJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2/t12-,13-,14+,15-,16-,17+/m0/s1 |
| SMILES |
C=C(CO)C(=O)OC1CC(=C)C2CC(O)C(=C)C2C2OC(=O)C(=C)C12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Saussurea neopulchella | Ref. |
| Plantae | Asteraceae | Saussurea puchella | Ref. |
| Plantae | Asteraceae | Saussurea pulchella  | Ref. |
|
|
zoom in
| Organism | Saussurea puchella | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|