| Name |
Picrotoxinin |
| Formula |
C15H16O6 |
| Mw |
292.09468824 |
| CAS RN |
17617-45-7 |
| C_ID |
C00003350
, 
|
| InChIKey |
PIMZUZSSNYHVCU-XZZXVEBBNA-N |
| InChICode |
InChI=1S/C15H16O6/c1-5(2)7-8-11(16)19-9(7)10-13(3)14(8,18)4-6-15(13,21-6)12(17)20-10/h6-10,18H,1,4H2,2-3H3/t6-,7+,8-,9-,10-,13-,14-,15+/m1/s1 |
| SMILES |
C=C(C)[C@@H]1[C@H]2OC(=O)[C@@H]1[C@]1(O)C[C@H]3O[C@]34C(=O)O[C@H]2[C@]14C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Anamirta cocculus  | Ref. |
| Plantae | Menispermaceae | Cocculus indicus | Ref. |
|
|
zoom in
| Organism | Cocculus indicus | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|