| Name |
Trichodermin |
| Formula |
C17H24O4 |
| Mw |
292.16745925 |
| CAS RN |
4682-50-2 |
| C_ID |
C00003195
, 
|
| InChIKey |
HNEGCRMUYSKRRR-UPCSHNQZNA-N |
| InChICode |
InChI=1S/C17H24O4/c1-10-5-6-15(3)12(7-10)21-14-8-13(20-11(2)18)16(15,4)17(14)9-19-17/h7,12-14H,5-6,8-9H2,1-4H3/t12-,13-,14?,15+,16-,17+/m1/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@H]2O[C@@H]3C=C(C)CC[C@]3(C)[C@]1(C)[C@]21CO1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Hypocreaceae | Trichoderma spp. | Ref. |
| Fungi | Hypocreaceae | Trichoderma virida | Ref. |
| Fungi | Hypocreaceae | Trichoderma viride | Ref. |
| Fungi | Incertae sedis | Myrothecium roridum | Ref. |
| Fungi | Incertae sedis | Trichothecium roseum | Ref. |
| - | - | Dendrostillbella sp. | Ref. |
| - | - | Memnoniella echinata | Ref. |
| - | - | Stachybotrys chartarum | Ref. |
|
|
zoom in
| Organism | Trichoderma virida | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|