| Name |
Sclerosporin |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
66419-03-2 |
| C_ID |
C00003184
, 
|
| InChIKey |
WMNZIVZTRJKKHL-QTZZOOGMNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-9(2)11-6-7-13(15(16)17)12-5-4-10(3)8-14(11)12/h7-9,11-12,14H,4-6H2,1-3H3,(H,16,17)/t11-,12+,14-/m1/s1 |
| SMILES |
CC1=C[C@@H]2[C@@H](C(C)C)CC=C(C(=O)O)[C@@H]2CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Sclerotiniaceae | Sclerotinia fructicola | Ref. |
| Fungi | Sclerotiniaceae | Sclerotinia fruticola | Ref. |
|
|
zoom in
| Organism | Sclerotinia fruticola | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|