| Name |
Pinguisone |
| Formula |
C15H20O2 |
| Mw |
232.14632988 |
| CAS RN |
22489-40-3 |
| C_ID |
C00003173
, 
|
| InChIKey |
LJFIDWTVIFBAAF-OZJLUUOINA-N |
| InChICode |
InChI=1S/C15H20O2/c1-9-7-13(16)15(4)10(2)11-5-6-17-12(11)8-14(9,15)3/h5-6,9-10H,7-8H2,1-4H3/t9-,10-,14+,15-/m1/s1 |
| SMILES |
C[C@@H]1CC(=O)[C@@]2(C)[C@H](C)c3ccoc3C[C@@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Aneura pinguis | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa  | Ref. |
|
|
zoom in
| Organism | Agrimonia pilosa |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
