| Name |
Carotol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
465-28-1 |
| C_ID |
C00003109
, 
|
| InChIKey |
XZYQCFABZDVOPN-CKNGHHRPNA-N |
| InChICode |
InChI=1S/C15H26O/c1-11(2)13-7-9-14(4)8-5-12(3)6-10-15(13,14)16/h5,11,13,16H,6-10H2,1-4H3/t13-,14+,15+/m1/s1 |
| SMILES |
CC1=CC[C@@]2(C)CC[C@H](C(C)C)[C@@]2(O)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|