| Name |
Pyrethrin I |
| Formula |
C21H28O3 |
| Mw |
328.20384476 |
| CAS RN |
121-21-1 |
| C_ID |
C00003056
, 
|
| InChIKey |
ROVGZAWFACYCSP-BUVYOBQGNA-N |
| InChICode |
InChI=1S/C21H28O3/c1-7-8-9-10-15-14(4)18(12-17(15)22)24-20(23)19-16(11-13(2)3)21(19,5)6/h7-9,11,16,18-19H,1,10,12H2,2-6H3/b9-8-/t16-,18-,19-/m0/s1 |
| SMILES |
C=C/C=CCC1=C(C)[C@@H](OC(=O)[C@@H]2[C@@H](C=C(C)C)C2(C)C)CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tanacetum cinerariifolium  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
|
|
zoom in
| Organism | Paeonia albiflora | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|