| Name |
Uncinatone |
| Formula |
C20H22O4 |
| Mw |
326.15180919 |
| CAS RN |
99624-92-7 |
| C_ID |
C00003021
, 
|
| InChIKey |
IQGPVLVWUUPQMQ-AITLEWSLNA-N |
| InChICode |
InChI=1S/C20H22O4/c1-9-5-6-20(4)13(11(9)3)8-14(21)15-16(20)18(23)19-12(17(15)22)7-10(2)24-19/h8,10,22-23H,5-7H2,1-4H3/t10-,20-/m0/s1 |
| SMILES |
CC1=C(C)C2=CC(=O)c3c(O)c4c(c(O)c3[C@@]2(C)CC1)O[C@@H](C)C4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clerodendrum bungei Steud  | Ref. |
| Plantae | Labiatae | Clerodendrum nucinatum | Ref. |
| Plantae | Labiatae | Clerodendrum uncinatum  | Ref. |
| Plantae | Verbenaceae | Clerodendron uncinatum | Ref. |
|
|
zoom in
| Organism | Clerodendrum nucinatum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Costa-Lotufo, et al., Planta Med, 70, (2004), 180 |
|---|
|