| Name |
Robustaol A |
| Formula |
C25H30O9 |
| Mw |
474.18898256 |
| CAS RN |
78411-76-4 |
| C_ID |
C00003016
, 
|
| InChIKey |
VQIUVVRPDIFIPV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H30O9/c1-10(2)7-16(27)17-22(31)14(21(30)15(9-26)24(17)33)8-13-20(29)12(5)25(34-6)18(23(13)32)19(28)11(3)4/h9-11,29-33H,7-8H2,1-6H3 |
| SMILES |
COc1c(C)c(O)c(Cc2c(O)c(C=O)c(O)c(C(=O)CC(C)C)c2O)c(O)c1C(=O)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Myrtaceae | Eucalyptus berghei | Ref. |
| Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
|
|
zoom in
| Organism | Eucalyptus robusta | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|