| Name |
Arnebinol |
| Formula |
C16H20O2 |
| Mw |
244.14632988 |
| CAS RN |
87064-17-3 |
| C_ID |
C00002979
, 
|
| InChIKey |
BSXTWYDVYNXVHH-YKNDAMCPSA-N |
| InChICode |
InChI=1S/C16H20O2/c1-12-4-3-5-13(2)11-18-15-8-9-16(17)14(10-15)7-6-12/h5-6,8-10,17H,3-4,7,11H2,1-2H3/b12-6+,13-5+ |
| SMILES |
C/C1=CCc2cc(ccc2O)OC/C(C)=C/CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
|
|
zoom in
| Organism | Arnebia hispidissima | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|