| Name |
Afzelechin-(4alpha->8)-afzelechin |
| Formula |
C30H26O10 |
| Mw |
546.15259705 |
| CAS RN |
101339-37-1 |
| C_ID |
C00002906
, 
|
| InChIKey |
JESPWQGCCOLVKQ-KJNMLZBZNA-N |
| InChICode |
InChI=1S/C30H26O10/c31-15-5-1-13(2-6-15)28-22(37)11-18-19(34)12-21(36)25(30(18)40-28)26-24-20(35)9-17(33)10-23(24)39-29(27(26)38)14-3-7-16(32)8-4-14/h1-10,12,22,26-29,31-38H,11H2/t22-,26-,27-,28+,29+/m0/s1 |
| SMILES |
Oc1ccc([C@H]2Oc3cc(O)cc(O)c3[C@@H](c3c(O)cc(O)c4c3O[C@H](c3ccc(O)cc3)[C@@H](O)C4)[C@@H]2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
|
|
zoom in
| Organism | Taxus cuspidata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|