| Name |
Anthragallol |
| Formula |
C14H8O5 |
| Mw |
256.03717337 |
| CAS RN |
602-64-2 |
| C_ID |
C00002792
, 
|
| InChIKey |
AHKDJQYHVWSRLT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H8O5/c15-9-5-8-10(14(19)13(9)18)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,15,18-19H |
| SMILES |
O=C1c2ccccc2C(=O)c2c1cc(O)c(O)c2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Relbunium hypocarpium | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|