| Name |
Methylisoeugenol
trans-Methyl isoeugenol |
| Formula |
C11H14O2 |
| Mw |
178.09937969 |
| CAS RN |
6379-72-2 |
| C_ID |
C00002760
, 
|
| InChIKey |
NNWHUJCUHAELCL-SNAWJCMRSA-N |
| InChICode |
InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4+ |
| SMILES |
C/C=C/c1ccc(OC)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus gramineus | Ref. |
| Plantae | Anacardiaceae | Mangifera indica | Ref. |
| Plantae | Annonaceae | Annona glabra | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Aristolochiaceae | Asarum europaeum | Ref. |
| Plantae | Myristicaceae | Myristica fragrans | Ref. |
| Plantae | Myrtaceae | Myrtus communis | Ref. |
| Plantae | Poaceae | Cymbopogon goeringii | Ref. |
|
|
zoom in
| Organism | Acorus gramineus |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
