| Name |
Isosafrole |
| Formula |
C10H10O2 |
| Mw |
162.06807956 |
| CAS RN |
120-58-1 |
| C_ID |
C00002753
, 
|
| InChIKey |
VHVOLFRBFDOUSH-NSCUHMNNSA-N |
| InChICode |
InChI=1S/C10H10O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2-6H,7H2,1H3/b3-2+ |
| SMILES |
C/C=C/c1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Apiaceae | Angelica acutiloba  | Ref. |
| Plantae | Apiaceae | Ligusticum acutilobum | Ref. |
| Plantae | Illiciaceae | Illicium religiosum | Ref. |
| Plantae | Rutaceae | Murraya koenigii  | Ref. |
|
|
zoom in
| Organism | Angelica acutiloba | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|