| Name |
Rottlerin |
| Formula |
C30H28O8 |
| Mw |
516.17841787 |
| CAS RN |
82-08-6 |
| C_ID |
C00002708
, 
|
| InChIKey |
DEZFNHCVIZBHBI-ZHACJKMWSA-N |
| InChICode |
InChI=1S/C30H28O8/c1-15-24(33)19(27(36)22(16(2)31)25(15)34)14-20-26(35)18-12-13-30(3,4)38-29(18)23(28(20)37)21(32)11-10-17-8-6-5-7-9-17/h5-13,33-37H,14H2,1-4H3/b11-10+ |
| SMILES |
CC(=O)c1c(O)c(C)c(O)c(Cc2c(O)c3c(c(C(=O)/C=C/c4ccccc4)c2O)OC(C)(C)C=C3)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Mallotus philippensis  | Ref. |
| Plantae | Euphorbiaceae | Mallotus philippinensis  | Ref. |
| Plantae | Euphorbiaceae | Rottlera tinctoria | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polygonaceae | Rheum undulatum  | Ref. |
| Plantae | Rhamnaceae | Rhamnus purshiana  | Ref. |
|
|
zoom in
| Organism | Mallotus philippinensis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|