| Name |
Turricolol E |
| Formula |
C21H30O3 |
| Mw |
330.21949482 |
| CAS RN |
101392-12-5 |
| C_ID |
C00002680
, 
|
| InChIKey |
SNVNUOWZKGGIRP-ASKQTUSVSA-N |
| InChICode |
InChI=1S/C21H30O3/c1-16(2)6-4-8-18(15-22)9-5-7-17(3)10-11-19-14-20(23)12-13-21(19)24/h6,9-10,12-14,22-24H,4-5,7-8,11,15H2,1-3H3/b17-10+,18-9- |
| SMILES |
CC(C)=CCC/C(=C/CC/C(C)=C/Cc1cc(O)ccc1O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hydrophyllaceae | Turricula parryi | Ref. |
| - | - | family Hydrophyllaceae spp. | Ref. |
|
|
zoom in
| Organism | family Hydrophyllaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|