| Name |
Trichocarpin |
| Formula |
C20H22O9 |
| Mw |
406.1263823 |
| CAS RN |
10590-85-9 |
| C_ID |
C00002677
, 
|
| InChIKey |
QJWRHLSORLOREK-QEJFGZDQNA-N |
| InChICode |
InChI=1S/C20H22O9/c21-9-15-16(23)17(24)18(25)20(29-15)28-14-7-6-12(22)8-13(14)19(26)27-10-11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2/t15-,16-,17+,18-,20-/m1/s1 |
| SMILES |
O=C(OCc1ccccc1)c1cc(O)ccc1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
|
|
zoom in
| Organism | Salix babylonica |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
