| Name |
4-Methylcatechol |
| Formula |
C7H8O2 |
| Mw |
124.0524295 |
| CAS RN |
452-86-8 |
| C_ID |
C00002660
, 
|
| InChIKey |
ZBCATMYQYDCTIZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| SMILES |
Cc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
