| Name |
Sesartemin |
| Formula |
C23H26O8 |
| Mw |
430.16276781 |
| CAS RN |
77394-27-5 |
| C_ID |
C00002627
, 
|
| InChIKey |
DHWUVPPRBIJJKS-NXHQQXHPNA-N |
| InChICode |
InChI=1S/C23H26O8/c1-24-16-5-12(6-17(25-2)22(16)27-4)20-14-9-29-21(15(14)10-28-20)13-7-18(26-3)23-19(8-13)30-11-31-23/h5-8,14-15,20-21H,9-11H2,1-4H3/t14-,15-,20+,21+/m0/s1 |
| SMILES |
COc1cc([C@H]2OC[C@H]3[C@@H]2CO[C@@H]3c2cc(OC)c3c(c2)OCO3)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia absinthium  | Ref. |
| Plantae | Asteraceae | Artemisia apiacea  | Ref. |
| Plantae | Myristicaceae | Virola elongata | Ref. |
|
|
zoom in
| Organism | Artemisia apiacea | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
MA, et al., Chem Pharm Bull, 49, (2001), 183 |
|---|
|