| Name |
Saucernetin |
| Formula |
C22H28O5 |
| Mw |
372.193674 |
| CAS RN |
83377-13-3 |
| C_ID |
C00002623
, 
|
| InChIKey |
JLJAVUZBHSLLJL-RONXCAPDNA-N |
| InChICode |
InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21+,22+/m0/s1 |
| SMILES |
COc1ccc([C@@H]2O[C@@H](c3ccc(OC)c(OC)c3)[C@@H](C)[C@@H]2C)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Saururaceae | Saururus cernuus | Ref. |
| Plantae | Saururaceae | Saururus chinensis  | Ref. |
|
|
zoom in
| Organism | Saururus chinensis | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Hwang, et al., Phytochemistry, 64, (2003), 765 |
|---|
|