| Name |
Phrymarolin I |
| Formula |
C24H24O11 |
| Mw |
488.13186161 |
| CAS RN |
38303-95-6 |
| C_ID |
C00002617
, 
|
| InChIKey |
ZGBQEJGNORPNKC-PWNOOFOSNA-N |
| InChICode |
InChI=1S/C24H24O11/c1-12(25)35-24-9-29-22(13-4-17-18(31-10-30-17)5-15(13)26-2)14(24)8-28-23(24)34-21-7-20-19(32-11-33-20)6-16(21)27-3/h4-7,14,22-23H,8-11H2,1-3H3/t14-,22-,23+,24-/m1/s1 |
| SMILES |
COc1cc2c(cc1O[C@@H]1OC[C@@H]3[C@@H](c4cc5c(cc4OC)OCO5)OC[C@]13OC(C)=O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Phrymaceae | Phryma leptostachya | Ref. |
| - | - | Sparanskia tuberculata | Ref. |
|
|
zoom in
| Organism | Sparanskia tuberculata | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|