| Name |
4'-Demethyldeoxypodophyllotoxin 4'-Demethyldesoxypodophyllotoxin |
| Formula |
C21H20O7 |
| Mw |
384.12090299 |
| CAS RN |
3590-93-0 |
| C_ID |
C00002594
, 
|
| InChIKey |
RFDMNXDDRXVJTM-MJUJRNRDNA-N |
| InChICode |
InChI=1S/C21H20O7/c1-24-16-5-11(6-17(25-2)20(16)22)18-13-7-15-14(27-9-28-15)4-10(13)3-12-8-26-21(23)19(12)18/h4-7,12,18-19,22H,3,8-9H2,1-2H3/t12-,18+,19-/m0/s1 |
| SMILES |
COc1cc([C@@H]2c3cc4c(cc3C[C@H]3COC(=O)[C@@H]32)OCO4)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
| Plantae | Berberidaceae | Sinopodophyllum emodi | Ref. |
| Plantae | Labiatae | Hyptis verticillata  | Ref. |
| Plantae | Polygalaceae | Polygala macradenia | Ref. |
| Plantae | Polygalaceae | Polygala paena | Ref. |
|
|
zoom in
| Organism | Podophyllum peltatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|