| Name |
Texasin 6,7-Dihydroxy-4'-methoxyisoflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
897-46-1 |
| C_ID |
C00002579
, 
|
| InChIKey |
GCWOYVFHJDNKIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-15-7-14(18)13(17)6-11(15)16(12)19/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)c(O)cc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Baptisia australis | Ref. |
| Plantae | Fabaceae | Baptisia leucantha | Ref. |
| Plantae | Fabaceae | Myroxylon peruiferum  | Ref. |
| Plantae | Fabaceae | Platymiscium praecox | Ref. |
|
|
zoom in
| Organism | Baptisia leucantha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braga de Oliveira,Phytochem.,11,(1972),3515
Markham,Phytochem.,9,(1970),2359 |
|---|
|