| Name |
Orobol Norsantal Santol 5,7,3',4'-Tetrahydroxyisoflavone |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
480-23-9 |
| C_ID |
C00002554
, 
|
| InChIKey |
IOYHCQBYQJQBSK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| SMILES |
O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Bolusanthus specious | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lathyrus montanus  | Ref. |
| Plantae | Fabaceae | Lathyrus nissolia | Ref. |
| Plantae | Fabaceae | Lathyrus spp. | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
| Plantae | Moraceae | Maclura tinctoria  | Ref. |
| - | - | Stemphilium sp. No. 644 | Ref. |
|
|
zoom in
| Organism | Calophyllum polyanthum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Kurihara, et al., Chem Abstr, 93, (1980), 235183w.
Matsuda, et al., Planta Med, 70, (2004), 1201.
Ma, et al., JNP, 67, (2004), 1598 |
|---|
|