| Name |
4-Hydroxyhomopterocarpin Melilotocarpan A |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
61135-95-3 |
| C_ID |
C00002536
, 
|
| InChIKey |
YHSXPHNOIMTWTH-DETPSLMCNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-19-9-3-4-10-12-8-21-17-11(16(12)22-14(10)7-9)5-6-13(20-2)15(17)18/h3-7,12,16,18H,8H2,1-2H3/t12-,16-/m0/s1 |
| SMILES |
COc1ccc2c(c1)O[C@H]1c3ccc(OC)c(O)c3OC[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Trifolium hybridum  | Ref. |
| Plantae | Fabaceae | Trifolium pallescens | Ref. |
|
|
zoom in
| Organism | Melilotus alba | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Phytochem.,15,(1976),1489 |
|---|
|