| Name |
Glabridin |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
59870-68-7 |
| C_ID |
C00002529
, 
|
| InChIKey |
LBQIJVLKGVZRIW-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| SMILES |
CC1(C)C=Cc2c(ccc3c2OC[C@@H](c2ccc(O)cc2O)C3)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra var. typica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Myrcianthes pungens | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra var. typica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Saitoh,Chem.Pharm.Bull.,24,(1976),752
Mitscher,J.Nat.Prod.,43,(1980),259 |
|---|
|