| Name |
Genistein 7-O-glucoside Genistin Genistoside Genistein 7-O-beta-glucopyranoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
529-59-9 |
| C_ID |
C00002528
, 
|
| InChIKey |
ZCOLJUOHXJRHDI-NXBQWJJBNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Adenocarpus complicatus | Ref. |
| Plantae | Fabaceae | Baptisia bracteata | Ref. |
| Plantae | Fabaceae | Baptisia cinerea | Ref. |
| Plantae | Fabaceae | Baptisia lanceolata | Ref. |
| Plantae | Fabaceae | Baptisia lecontei | Ref. |
| Plantae | Fabaceae | Baptisia megacarpa | Ref. |
| Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
| Plantae | Fabaceae | Cytisus baeticus | Ref. |
| Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
| Plantae | Fabaceae | Genista aetnensis | Ref. |
| Plantae | Fabaceae | Genista depressa | Ref. |
| Plantae | Fabaceae | Genista ephedroides | Ref. |
| Plantae | Fabaceae | Genista tinctoria  | Ref. |
| Plantae | Fabaceae | Genista tridentata | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus hartwegii | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Medicago littoralis | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Fabaceae | Retama sphaerocarpa  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Thermopsis lanceolata | Ref. |
| Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
| Plantae | Fabaceae | Thermopsis mollis | Ref. |
| Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
| Plantae | Fabaceae | Thermopsis villosa | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Ulex nanus | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Adenocarpus complicatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Paris,Sceances Acad Sci.,257,(1963),1728 |
|---|
|