| Name |
Peucenidin |
| Formula |
C21H22O7 |
| Mw |
386.13655306 |
| CAS RN |
33044-93-8 |
| C_ID |
C00002492
, 
|
| InChIKey |
YTLKDGZSNPIHNO-MYKRFBFLNA-N |
| InChICode |
InChI=1S/C21H22O7/c1-11(2)10-16(24)28-21(4,5)20-19(25-12(3)22)17-14(26-20)8-6-13-7-9-15(23)27-18(13)17/h6-10,19-20H,1-5H3/t19-,20+/m1/s1 |
| SMILES |
CC(=O)O[C@@H]1c2c(ccc3ccc(=O)oc23)O[C@@H]1C(C)(C)OC(=O)C=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Peucedanum bourgaei | Ref. |
| Plantae | Apiaceae | Peucedanum oreoselinum  | Ref. |
| - | - | Libanotis pyrenaicum | Ref. |
|
|
zoom in
| Organism | Peucedanum oreoselinum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter35 |
|---|
|