| Name |
Micromelin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
15085-71-9 |
| C_ID |
C00002484
, 
|
| InChIKey |
VIORQNDMAWQQCV-OSTDYLDYNA-N |
| InChICode |
InChI=1S/C15H12O6/c1-15-13(21-15)12(20-14(15)17)8-5-7-3-4-11(16)19-9(7)6-10(8)18-2/h3-6,12-13H,1-2H3/t12-,13-,15-/m0/s1 |
| SMILES |
COc1cc2oc(=O)ccc2cc1[C@@H]1OC(=O)[C@@]2(C)O[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Micromelum integerrimum  | Ref. |
| Plantae | Rutaceae | Micromelum integrrimum | Ref. |
| Plantae | Rutaceae | Micromelum minutum  | Ref. |
| - | - | Caesaria graveolens | Ref. |
|
|
zoom in
| Organism | Micromelum integrrimum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|