| Name |
7-Methoxy-2,2-dimethylchromene Precocene 1 |
| Formula |
C12H14O2 |
| Mw |
190.09937969 |
| CAS RN |
17598-02-6 |
| C_ID |
C00002439
, 
|
| InChIKey |
CPTJXGLQLVPIGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
| SMILES |
COc1ccc2c(c1)OC(C)(C)C=C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina aromatica | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|